Fusidate Sodium
Fusidate Sodium (Fucidin, SQ-16360) is a sodium salt form of fusidic acid, a bacteriostatic antibiotic derived from the fungus Fusidium coccineum and used as a topical medication to treat skin infections.
| Trivial name | Fucidin, Sodium fusidate, SQ-16360 |
| Catalog Number | S4663 |
| Molecular Formula | C20H17ClFN3O3 |
| CAS# | 751-94-0 |
| Inchi | InChI=1S/C20H17ClFN3O3/c1-12(11-26)23-19(27)17-10-18(13-5-7-14(21)8-6-13)24-25(20(17)28)16-4-2-3-15(22)9-16/h2-10,12,26H,11H2,1H3,(H,23,27)/t12-/m0/s1 |
| Inchi Key | RFGRNBWAUZSMBN-LBPRGKRZSA-N |
| SMILES | CC(CO)NC(=O)C1=CC(=NN(C1=O)C2=CC(=CC=C2)F)C3=CC=C(C=C3)Cl |
| Size | 20mg |
| Supplier Page | http://www.selleckchem.com/products/fusidate-sodium.html |
| Additional Information | https://file.selleck.cn/downloads/struct/fusidate-sodium-chemical-structure-s4663.gif |
