Fusidate Sodium
Fusidate Sodium (Fucidin, SQ-16360) is a sodium salt form of fusidic acid, a bacteriostatic antibiotic derived from the fungus Fusidium coccineum and used as a topical medication to treat skin infections.
| Trivial name | Fucidin, Sodium fusidate, SQ-16360 |
| Catalog Number | S4663 |
| Molecular Formula | C31H47O6.Na |
| CAS# | 751-94-0 |
| Inchi | InChI=1S/C31H48O6.Na/c1-17(2)9-8-10-20(28(35)36)26-22-15-24(34)27-29(5)13-12-23(33)18(3)21(29)11-14-30(27,6)31(22,7)16-25(26)37-19(4)32;/h9,18,21-25,27,33-34H,8,10-16H2,1-7H3,(H,35,36);/q;+1/p-1/b26-2 0-;/t18-,21-,22-,23+,24+,25-,27-,29-,30-,31-;/m0./s1 |
| Inchi Key | HJHVQCXHVMGZNC-JCJNLNMISA-M |
| SMILES | CC1C2CCC3(C(C2(CCC1O)C)C(CC4C3(CC(C4=C(CCC=C(C)C)C(=O)[O-])OC(=O)C)C)O)C.[Na+] |
| Size | 20mg |
| Supplier Page | http://www.selleckchem.com/products/fusidate-sodium.html |
| Additional Information | https://file.selleck.cn/downloads/struct/fusidate-sodium-chemical-structure-s4663.gif |