Sodium fusidate
API Standard
| Catalog Number | CS-O-02334 |
| Alternative Name(s) | sodium 2-[(1S,2S,5R,6S,7S,10S,11S,13S,14Z,15R,17R)-131-tetramethylte.0,5]heptadecan-14-ylidene]-6-methylhept-5-enoate |
| Research Area | Fusidic Acid Sodium Salt is a bacteriostatic antibiotic. Fusidic Acid suppresses nitric oxide lysis of pancreatic islet cells. Inhibits protein synthesis in prokaryotes by inhibiting the ribosome-dependent activity of G factor and translocation of peptidy |
| Molecular Formula | C31H47NaO6 |
| CAS# | 751-94-0 |
| Purity | >98% |
| SMILES | C[C@@]([C@]([C@H](O)C1)([H])[C@]2(CC[C@H]3O)C)(CC[C@@]2([H])[C@@H]3C)[C@]([C@]1([H])/C4=C(C([O-])=O)CC/C=C(C)C)(C[C@@H]4OC(C)=O)C.[Na+] |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02334.html |