Obacunone
Obacunone, a natural product isolated and purified from the barks of Phellodendron chinense, has cytotoxicity in androgen-dependent human prostate cancer cells. Obacunone may have the potential to prevent estrogen-responsive breast cancer through inhibition of the aromatase enzyme and inflammatory pathways, as well as activation of apoptosis.
| Trivial name | / |
| Catalog Number | CSN15677 |
| Alternative Name(s) | / |
| Research Area | Cancer|Immunology/Inflammation |
| Molecular Formula | C26H30O7 |
| CAS# | 751-03-1 |
| Purity | ≥98% |
| SMILES | CC1([C@]([C@](C=CC(O1)=O)([C@@]([C@@]23C)([H])CC[C@@]([C@](O4)([H])C5=COC=C5)([C@]36[C@@](O6)([H])C4=O)C)C)([H])CC2=O)C |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/obacunone.html |
