Temarotene
Temarotene is a synthetic bioactive retinoid with differentiation inducing and potential antineoplastic activitiesa and activates retinoic acid receptors (RARs).
| Trivial name | Arotinoid; Ro 15-0778; Ro-15-0778; Ro15-0778; |
| Catalog Number | CSN21850 |
| Alternative Name(s) | Arotinoid; Ro 15-0778; Ro-15-0778; Ro15-0778; |
| Research Area | / |
| Molecular Formula | C23H28 |
| CAS# | 75078-91-0 |
| Purity | ≥98% |
| SMILES | C/C(C1=CC2=C(C(C)(C)CCC2(C)C)C=C1)=C\C3=CC=CC=C3 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/temarotene.html |