Temarotene
Temarotene is a synthetic bioactive retinoid with differentiation inducing and potential antineoplastic activitiesa and activates retinoic acid receptors (RARs).
Trivial name | Arotinoid; Ro 15-0778; Ro-15-0778; Ro15-0778; |
Catalog Number | CSN21850 |
Alternative Name(s) | Arotinoid; Ro 15-0778; Ro-15-0778; Ro15-0778; |
Research Area | / |
Molecular Formula | C23H28 |
CAS# | 75078-91-0 |
Purity | ≥98% |
SMILES | C/C(C1=CC2=C(C(C)(C)CCC2(C)C)C=C1)=C\C3=CC=CC=C3 |
Size | 1mg |
Supplier Page | https://www.csnpharm.com/products/temarotene.html |