Enzalutamide Impurity B
4-Bromo-2-fluoro-N-methylbenzamide is an intermediate in the synthesis of MDV 3100 , is an androgen-receptor antagonist that blocks androgens from binding to the androgen receptor and prevents nuclear translocation and co-activator recruitment of the ligand-receptor complex.
| Catalog Number | CS-T-49774 |
| Alternative Name(s) | 4-Bromo-2-fluoro-N-methylbenzamide. |
| Molecular Formula | C8H7BrFNO |
| CAS# | 749927-69-3 |
| Purity | >98% |
| SMILES | O=C(C(C=CC(Br)=C1)=C1F)NC |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST49774.html |
