Cefpiramide sodium
Cefpiramide sodium (CPMS, SM-1652,wy-44635) is an anionic β-lactam antibiotic. It exhibits antibacterial activity against gram-positive and gram-negative bacteria, in particular, to Pseudomonas aeruginosa, which can result in achronic life-threatening infection in the lungs of cystic fibrosis patients.
| Trivial name | SM-1652, wy-44635 |
| Catalog Number | S5353 |
| Molecular Formula | C18H16O5 |
| CAS# | 74849-93-7 |
| Inchi | InChI=1S/C18H16O5/c1-20-15-10-14-16(18(22-3)17(15)21-2)12(19)9-13(23-14)11-7-5-4-6-8-11/h4-10H,1-3H3 |
| Inchi Key | HJNJAUYFFFOFBW-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C2C(=C1)OC(=CC2=O)C3=CC=CC=C3)OC)OC |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/cefpiramide-sodium.html |
| Additional Information | https://file.selleck.cn/downloads/struct/cefpiramide-sodium-chemical-structure-s5353.gif |
