16(S)-Iloprost | MedChemExpress (MCE)
16(S)-Iloprost is a stereoisomer of Iloprost. 16(S)-Iloprost inhibited platelet aggregation with IC50 value of 3.5 nM, and balanced binding with platelet membrane receptors Kd value of 13.4 nM[1].
| Trivial name | 16(S)-Iloprost |
| Catalog Number | HY-118670 |
| Research Area | Cardiovascular Disease |
| CAS# | 74843-14-4 |
| Purity | ≥98.0% |
| SMILES | O[C@@H]1C[C@@H]([C@@H]([C@H]1/C=C/[C@H]([C@H](CC#CC)C)O)C/2)CC2=C/CCCC(O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/16-s-iloprost.html |