Methylophiopogonanone B
Methylophiopogonanone B, a natural product isolated and purified from the roots of Ophiopogon japonicus, induces cell morphological change and Rho activation via melanocyte dendrite retraction and stress fiber formation.
| Trivial name | MOPB |
| Catalog Number | CSN13988 |
| Alternative Name(s) | MOPB |
| Research Area | / |
| Molecular Formula | C19H20O5 |
| CAS# | 74805-91-7 |
| Purity | ≥98% |
| SMILES | O=C1[C@H](CC2=CC=C(OC)C=C2)COC3=C(C)C(O)=C(C)C(O)=C13 |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/methylophiopogonanone-b.html |