Zaltoprofen
API Standard
| Catalog Number | CS-O-02603 |
| Alternative Name(s) | 2-(10-oxo-10,11-dihydrodibenzo[b,f]thiepin-2-yl)propanoc cid |
| Research Area | Zaltoprofen, a novel NSAID, is prescribed for the treatment of lumbar pain, frozen shoulder, osteoarthritis, musculoskeletal pain, dental pain, post-operative pain, cervicobrachial syndrome, other pain and inflammatory conditions. The drug exerts antiphlogistic and analgesic effects. |
| Molecular Formula | C17H14O3S |
| CAS# | 74711-43-6 |
| Purity | >98% |
| SMILES | CC(C1=CC=C(SC2=C3C=CC=C2)C(CC3=O)=C1)C(O)=O |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02603.html |