Hydroxychloroquine Sulfate 10mM * 1mL in DMSO
Hydroxychloroquine Sulfate is an antimalarial agent used for the treatment of systemic lupus erythematosus, rheumatoid arthritis and other autoimmune, inflammatory and dermatologic conditions.
| Trivial name | Hydroxychloroquine Sulfate 10mM * 1mL in DMSO |
| Catalog Number | A14208-10mM-D |
| Alternative Name(s) | 2-[[4-[(7-chloro-4-quinolinyl)amino]pentyl]ethylamino]-ethanol, sulfate (1:1) |
| Molecular Formula | C18H28ClN3O5S |
| CAS# | 747-36-4 |
| SMILES | CCN(CCCC(C)NC1=C2C=CC(=CC2=NC=C1)Cl)CCO.OS(=O)(=O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/hydroxychloroquine-sulfate.html |
