MMAF
Anti-mitotic/anti-tubulin/antineoplastic agent
| Catalog Number | B3270-10 |
| Molecular Formula | C39H65N5O8 |
| CAS# | 745017-94-1 |
| Purity | 96.99% |
| SMILES | CCC(C)C(C(CC(=O)N1CCCC1C(C(C)C(=O)NC(CC2=CC=CC=C2)C(=O)O)OC)OC)N(C)C(=O)C(C(C)C)NC(=O)C(C(C)C)NC |
| Size | 10mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B3270 |
