Prostaglandin E1
API Standard
| Catalog Number | CS-O-05672 |
| Alternative Name(s) | 7-((1R,2R,3R)-3-hydroxy-2-((S,E)-3-hydroxyoct-1-en-1-yl)-5-oxocyclopentyl)heptanoic acid; Prostaglandin E1 (PGE1); PGE1; Alprostadil |
| Research Area | Alprostadil is a potent vasodilator agent that increases peripheral blood flow, inhibits platelet aggregation, and induces bronchodilation. Used in the treatment of erectile dysfunction, this agent produces corporal smooth muscle relaxation by binding to |
| Molecular Formula | C20H34O5 |
| CAS# | 745-65-3 |
| Purity | >98% |
| SMILES | O=C1[C@@H]([C@H]([C@H](O)C1)/C=C/[C@@H](O)CCCCC)CCCCCCC(O)=O |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO05672.html |
