Prostaglandin E1 (PGE1) 50mg
Prostaglandin E1 (PGE1) is the theoretical cyclooxygenase metabolite of dihomo-??-linolenic acid (DGLA), but it is virtually undetectable in the plasma of normal humans or other animals. The IC50 of PGE1 for the inhibition of ADP-induced human platelet aggregation is 40 nM.
| Trivial name | Prostaglandin E1 (PGE1) 50mg |
| Catalog Number | A11820-50 |
| Alternative Name(s) | N/A |
| Molecular Formula | C20H34O5 |
| CAS# | 745-65-3 |
| SMILES | CCCCC[C@@H](/C=C/[C@H]1[C@@H](CC(=O)[C@@H]1CCCCCCC(=O)O)O)O |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/prostaglandin-e1-pge1.html |
