(22R)-33,34,35-Trinorbacteriohopan-32-oic acid | MedChemExpress (MCE)
(22R)-33,34,35-Trinorbacteriohopan-32-oic acid (compound 2c) is a hapten that can be covalently coupled to a carrier protein. (22R)-33,34,35-Trinorbacteriohopan-32-oic acid can be used in antibody generation and immunoassay[1].
| Trivial name | (22R)-33,34,35-Trinorbacteriohopan-32-oic acid |
| Catalog Number | HY-157186 |
| Research Area | Inflammation/Immunology |
| CAS# | 74431-96-2 |
| Purity | ≥98.00% |
| SMILES | C[C@]12[C@@](CC[C@@]3([H])[C@]2(CC[C@]4([H])[C@@]3(CC[C@]4([H])[C@H](C)CCC(O)=O)C)C)([H])[C@@]5([C@@](C(C)(CCC5)C)([H])CC1)C |
| PubChem Chemical Structure ID | 169494436 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/22r-33-34-35-trinorbacteriohopan-32-oic-acid.html |