NSD-IN-3 | MedChemExpress (MCE)
NSD-IN-3 (compound 3) is a potent nuclear receptor binding SET domain (NSD) inhibitor. NSD-IN-3 inhibits NSD2-SET and NSD3-SET with IC50 values of 0.81 μM and 0.84 μM, respectively. NSD-IN-3 inhibits histone H3K36 dimethylation and decreases the expression of NSDs-targeted genes in non-small cell lung cancer cells. NSD-IN-3 induces s-phase cell cycle arrest and apoptosis[1].
| Trivial name | NSD-IN-3 |
| Catalog Number | HY-162308 |
| Research Area | Cancer |
| CAS# | 744260-15-9 |
| Purity | ≥98.0% |
| SMILES | NC1=C2C(N(CCOC3=CC=C(Br)C=C3)C=N2)=NC=N1 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/nsd-in-3.html |