OSU-03012 (AR-12)
OSU-03012 (AR-12) is a potent inhibitor of recombinant PDK-1(phosphoinositide-dependent kinase 1) with IC50 of 5 μM in a cell-free assay and 2-fold increase in potency over OSU-02067.
| Trivial name | N/A |
| Catalog Number | S1106 |
| Molecular Formula | C9H10O4 |
| CAS# | 742112-33-0 |
| Inchi | InChI=1S/C9H10O4/c1-12-6-4-3-5-7(13-2)8(6)9(10)11/h3-5H,1-2H3,(H,10,11) |
| Inchi Key | MBIZFBDREVRUHY-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC=C1)OC)C(=O)O |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/OSU-03012.html |
| Additional Information | https://file.selleck.cn/downloads/struct/OSU-03012-chemical-structure-S1106.gif |
