R547
R547 (Ro 4584820) is a potent ATP-competitive inhibitor of CDK1/2/4 with Ki of 2 nM/3 nM/1 nM. It is less potent to CDK7 and GSK3α/β, while inactive to other kinases. Phase 1.
| Trivial name | Ro 4584820 |
| Catalog Number | S2688 |
| Molecular Formula | C20H18FN5O |
| CAS# | 741713-40-6 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | CC1=NC(=CC=C1)C2=N[NH]C=C2C3=CC(=C(F)C=C3)C4=C[N](CCO)N=C4 |
| Size | 2mg |
| Supplier Page | http://www.selleckchem.com/products/r547.html |
| Additional Information | https://file.selleck.cn/downloads/struct/R547-chemical-structure-s2688.gif |
