Kihadanin B | MedChemExpress (MCE)
Kihadanin B is a citrus limonoid that can be purified from the peels of immature Citrus unshiu. Kihadanin B suppresses adipogenesis through repression of the Akt-FOXO1-PPARγ axis in 3T3-L1 adipocytes[1].
| Trivial name | Kihadanin B |
| Catalog Number | HY-122959 |
| Research Area | Metabolic Disease |
| CAS# | 73793-68-7 |
| Purity | ≥98.00% |
| SMILES | C[C@]12[C@]34[C@@H](C(O[C@@H](C5=CC(O)OC5=O)[C@@]4(CC[C@]1([H])[C@@]6([C@@](C(C)(OC(C=C6)=O)C)([H])CC2=O)C)C)=O)O3 |
| PubChem Chemical Structure ID | 156766 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/kihadanin-b.html |