Acetylursolic Acid
Acetylursolic acid is a natural product isolated and purified from the herbs of Ilex paraguariensis with cytotoxic, antimalarial, antitumor and NO production inhibitory activities. Acetylursolic acid has inhibition against both acetylcholinesterase (AChE) and butyrylcholinesterase (BChE) enzymes.
| Trivial name | Ursolic Acid Acetate |
| Catalog Number | CSN13373 |
| Alternative Name(s) | Ursolic Acid Acetate |
| Research Area | / |
| Molecular Formula | C32H50O4 |
| CAS# | 7372-30-7 |
| Purity | ≥95% |
| SMILES | CC1(C)[C@@H](OC(C)=O)CC[C@]2(C)[C@@]3([H])CC=C4[C@]5([H])[C@@H](C)[C@H](C)CC[C@@](C(O)=O)5CC[C@](C)4[C@@](C)3CCC12 |
| Size | 2mg |
| Supplier Page | https://www.csnpharm.com/products/acetylursolic-acid.html |
