Xylazine
α2-adrenoceptor agonist
| Catalog Number | B3344-5.1 |
| Molecular Formula | C12H16N2S |
| CAS# | 7361-61-7 |
| Purity | 99.98% |
| SMILES | CC1=C(C(=CC=C1)C)NC2=NCCCS2 |
| Size | 10mM (in 1mL DMSO) |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B3344 |
