Mevastatin
API Standard
| Catalog Number | CS-O-30656 |
| Alternative Name(s) | Lovastatin Relatedcompound A; Lovastatin EP Impurity A ; Pravastatin Deshydroxy Impurity; Compactin; (S)-(1S,7S,8S,8aR)-8-(2-((2R,4R)-4-hydroxy-6-oxotetrahydro-2H-pyran-2-yl)ethyl)-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl 2-methylbutanoate |
| Research Area | Mevastatin or compactin is a cholesterol-lowering agent isolated from Penicillium citinium. It was the first discovered agent belonging to the class of cholesterol-lowering medications known as statins. |
| Molecular Formula | C23H34O5 |
| CAS# | 73573-88-3 |
| Purity | >98% |
| SMILES | C[C@@H](C=C1)[C@@H]([C@@](C1=CCC2)([H])[C@H]2OC([C@@H](C)CC)=O)CC[C@@H](OC3=O)C[C@H](C3)O |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30656.html |