Hydrocortisone D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02905 |
| Alternative Name(s) | Hydrocortisone D4;Cortisol-9,11,12,12-d4;Cortisol D4;Cortisol-D4, (8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-17-(2-hydro1,12,14,15,16penta[a]phenanthren-3-one-D4; (1R,2S,10S,11S,14R,15S,17S)-14,17-dihydroxy-14-(2- hydroxyacetyl)-2,15-dimethyl(1,16,16,17- 2H4)tetracyclo[8.7.0.02,7.011,15]heptadec-6- en-5-one;CS-T-51267 |
| Research Area | Labeled Hydrocortisone, intended for use as an internal standard for the quantification of Hydrocortisone by GC- or LC-mass spectrometry. |
| Molecular Formula | C21H26D4O5 |
| CAS# | 73565-87-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@]1([C@@]2(O)C(CO)=O)[C@](CC2)([H])[C@@](CCC3=CC4=O)([H])[C@]([C@]3(CC4)C)([2H])[C@](O)([2H])C1([2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02905.html |
| Additional Information | NULL |