α-Guanidinoglutaric acid | MedChemExpress (MCE)
α-Guanidinoglutaric acid is a guanidino compound first found in cobaltinduced epileptogenic focus tissue in the cerebral cortex of cats. α-Guanidinoglutaric acid induces epileptic seizures in rats after intraventricular administration[1].
| Trivial name | α-Guanidinoglutaric acid |
| Catalog Number | HY-130325 |
| Research Area | Neurological Disease |
| CAS# | 73477-53-9 |
| Purity | ≥98.00% |
| SMILES | O=C(O)CC[C@@H](C(O)=O)NC(N)=N |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/α-guanidinoglutaric-acid.html |