NSC 23766 25mg
NSC 23766 is a selective inhibitor of Rac1-GEF interaction. Prevents Rac1 activation by Rac-specific guanine nucleotide exchange factors (GEFs) TrioN and Tiam1 (IC50 ~ 50 ??M) without affecting Cdc42 or RhoA activation.
| Trivial name | NSC 23766 25mg |
| Catalog Number | A12546-25 |
| Alternative Name(s) | N6-[2-[[4-(Diethylamino)-1-methylbu?tyl]amino]-6-methyl-4-pyrimidinyl]-2-methyl-4,6-qu?inolinediamine trihydrochloride |
| Molecular Formula | C24H35N7.3HCl |
| CAS# | 733767-34-5 |
| SMILES | CCN(CC)CCCC(C)NC1=NC(=CC(=N1)NC2=CC3=C(C=C2)N=C(C=C3N)C)C.Cl |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/nsc-23766.html |
