BAY 61-3606 10mg
BAY 61-3606 is a cell-permeable imidazopyrimidine compound that acts as a potent, ATP-competitive, reversible, and highly selective inhibitor of Syk tyrosine kinase activity with no inhibitory effect against Btk, Fyn, Itk, Lyn, and Src.
| Trivial name | BAY 61-3606 10mg |
| Catalog Number | A11320-10 |
| Alternative Name(s) | 2-[[7-(3,4-Dimethoxyphenyl)imidazo[1,2-c]pyrimidin-5-yl]amino]pyridine-3-carboxamide hydrochloride |
| Molecular Formula | C20H18N6O3.HCl.H2O |
| CAS# | 732983-37-8 |
| SMILES | COC1=C(C=C(C=C1)C2=CC3=NC=CN3C(=N2)NC4=C(C=CC=N4)C(=O)N)OC |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/bay-61-3606.html |