Deoxynojirimycin HCl
Deoxynojirimycin HCl, a natural product isolated and purified from the root barks of Morus alba L., shows inhibitory activity against α-glucosidases, inhibitors of α-glucosidase are promising candidates for the development of antitype II diabetics and anti-AIDS drugs.
| Trivial name | 1-Deoxynojirimycin HCl |
| Catalog Number | CSN19778 |
| Alternative Name(s) | 1-Deoxynojirimycin HCl |
| Research Area | / |
| Molecular Formula | C6H14ClNO4 |
| CAS# | 73285-50-4 |
| Purity | ≥97% |
| SMILES | O[C@@H]1[C@@H](CO)NC[C@H](O)[C@H]1O.[H]Cl |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/deoxynojirimycin-hcl.html |