(±)5-HETE lactone
(±) 5-HETE Lactone is a unique marker for 5-lipoxygenase activation. (±) 5-HETE Lactone is a cyclic ester formed by acid-catalyzed nucleophilic addition of the C-5 hydroxyl to the C-1 carboxyl of (±)5-HETE. It inhibits 5-LO (5-lipoxygenase) (IC50=27 µM) from rat basophilic leukemia cells. The lactone form is several times more potent.
| Catalog Number | 73279-37-5 |
| Alternative Name(s) | 6-pentadeca-1,3,6,9-tetraenyloxan-2-one; 6-[(1E,3Z,6Z,9Z)-pentadeca-1,3,6,9-tetraenyl]oxan-2-one |
| Molecular Formula | C20H30O2 |
| CAS# | 73279-37-5 |
| Purity | ≥98% |
| Inchi | InChI=1S/C20H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-19-17-15-18-20(21)22-19/h6-7,9-10,12-14,16,19H,2-5,8,11,15,17-18H2,1H3/b7-6-,10-9-,13-12-,16-14+ |
| Inchi Key | QZMAEYDIHWEEAF-XTDASVJISA-N |
| Size | Please inquire |
| Supplier Page | https://www.bocsci.com/5-hete-lactone-cas-73279-37-5-item-205648.html |