FR900098 sodium | MedChemExpress (MCE)
FR900098 sodium is an antimalarial agent that inhibits 1-deoxy-d-xylulose-5-phosphate (DXP) reductoisomerase. FR900098 sodium has no significant acute toxicity or genotoxicity, and does not have the ability to cause chromosome breakage or heterogeneity. FR900098 sodium has no effect on bone marrow red blood cells in NMRI mice[1][2].
| Trivial name | FR900098 sodium |
| Catalog Number | HY-122817 |
| Research Area | Infection |
| CAS# | 73226-73-0 |
| Purity | ≥98.0% |
| SMILES | O=C(C)N(CCCP(O)(O[Na])=O)O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/fr900098-sodium.html |