Fluticasone Propionate EP Impurity D
Impurities
| Trivial name | NULL |
| Catalog Number | CS-T-62071 |
| Alternative Name(s) | Fluticasone Propionate EP Impurity D;Ticabesone Propionate;Fluticasone impurity D;(6a,11b,16a,17a)-6,9-Difluoro-11-hydroxy-16-methyl-3-oxo-17-(1-oxopropoxy)-androsta-1,4-diene-17-carbothioic Acid S-Methyl Ester; RS 35909-00-00-0;Ticabesone Propionate;(6S,9R,11S,13S,16R,17R)-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-17-((methylthio)carbonyl)-3-oxo-6,7,8,9,10,11,12,13,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthren-17-yl propionate. |
| Research Area | Ticabesone Propionate is an impurity of Fluticasone, an antiallergic, anti-asthmatic and anti-inflammatory agent. |
| Molecular Formula | C25H32F2O5S |
| CAS# | 73205-13-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(CC)O[C@@]([C@]([C@@]1([H])C2)(C[C@H](O)[C@](F)([C@]3(C=C4)C)[C@@]1([H])C[C@H](F)C3=CC4=O)C)([C@@H]2C)C(SC)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST62071.html |
| Additional Information | NULL |