Cordycepin
Cordycepin is a nucleoside adenosine derivative that acts as an anticancer and antifungal agent. Cordycepin inhibits growth of various tumor cells in vitro. It can be converted to 3′-deoxyadenosine triphosphate (3′-dATP), which inhibits ATP-dependent DNA synthesis. Cordycepin is also useful for the study of messenger RNA transcription.
| Trivial name | 3'-Deoxyadenosine |
| Catalog Number | CSN10693 |
| Alternative Name(s) | 3'-Deoxyadenosine |
| Research Area | Cancer|Infection |
| Molecular Formula | C10H13N5O3 |
| CAS# | 73-03-0 |
| Purity | ≥99% |
| SMILES | OC[C@@H]1C[C@H]([C@H](N2C=NC3=C2N=CN=C3N)O1)O |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/cordycepin.html |