Cordycepin 250mg
Nucleoside analog that acts as an anticancer and antifungal agent. Can be converted to 3′-deoxyadenosine triphosphate (3′-dATP), which inhibits ATP-dependent DNA synthesis. Inhibits growth of various tumor cells in vitro.
| Trivial name | Cordycepin 250mg |
| Catalog Number | A12033-250 |
| Alternative Name(s) | 3'-Deoxyadenosine |
| Molecular Formula | C10H13N5O3 |
| CAS# | 73-03-0 |
| SMILES | C1[C@H](O[C@H]([C@@H]1O)N2C=NC3=C2N=CN=C3N)CO |
| Size | 250mg |
| Supplier Page | http://www.adooq.com/cordycepin.html |
