BMS-707035 10mM * 1mL in DMSO
BMS-707035 is an HIV-1 integrase (IN) inhibitor. HIV-1 integrase (IN) represents a therapeutically advantageous viral target to treat HIV/AIDS in the clinic.
| Trivial name | BMS-707035 10mM * 1mL in DMSO |
| Catalog Number | A10156-10mM-D |
| Alternative Name(s) | N-[(4-fluorophenyl)methyl]-1,6-dihydro-5-hydroxy-1-methyl-6-oxo-2-(tetrahydro-1,1-dioxido-2H-1,2-thiazin-2-yl)-4-Pyrimidinecarboxamide |
| Molecular Formula | C17H19FN4O5S |
| CAS# | 729607-74-3 |
| SMILES | CN1C(=O)C(=C(N=C1N2CCCCS2(=O)=O)C(=O)NCC3=CC=C(C=C3)F)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/bms-707035.html |