(±)-Catechin
(±)-Catechin is an antioxidant flavonoid. Because it has the function of scavenging free radicals, it can slow down aging. (±)-Catechin also can be used in dye and tanning industry.
| Catalog Number | PIPE-0606 |
| Alternative Name(s) | 2-(3,4-Dihydroxyphenyl)chroman-3,5,7-triol L-Epicatechin 13392-26-2 |
| Research Area | Natural Extract |
| Molecular Formula | C15H14O6 |
| CAS# | 7295-85-4 |
| SMILES | C1C(C(OC2=CC(=CC(=C21)O)O)C3=CC(=C(C=C3)O)O)O |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/-catechin-item-9545.html |