(-)-Neplanocin A
(−)-Neplanocin A potently and irreversibly inactivates SAH hydrolase (Ki = 8.39 nM). It has antitumor activity against mouse leukemia L1210 cells and broad-spectrum antiviral activity. Neplanocin A is more potent against vesicular stomatitis than the reversible SAH hydrolase inhibitor 3-deazaneplanocin (ID50 = 0.07 and 0.3 μg/ml, respectively).
| Catalog Number | 72877-50-0 |
| Alternative Name(s) | NPC-A; (-)-9-(trans-2,trans-3-Dihydroxy-4-(hydroxymethyl)-cyclopent-4-enyl)-adenine; 5-(6-Amino-purin-9-yl)-3-hydroxymethyl-cyclopent-3-ene-1,2-diol |
| Molecular Formula | C11H13N5O3 |
| CAS# | 72877-50-0 |
| Purity | ≥98% |
| Inchi | InChI=1S/C11H13N5O3/c12-10-7-11(14-3-13-10)16(4-15-7)6-1-5(2-17)8(18)9(6)19/h1,3-4,6,8-9,17-19H,2H2,(H2,12,13,14)/t6-,8-,9+/m1/s1 |
| Inchi Key | XUGWUUDOWNZAGW-VDAHYXPESA-N |
| Size | Please inquire |
| Supplier Page | https://bio-fermen.bocsci.com/product/neplanocin-a-cas-72877-50-0-280728.html |