Dapiprazole HCl
Dapiprazole HCl is an α1-adrenergic antagonist in the smooth muscle of blood vessels, used to reverse mydriasis after eye examination.
Trivial name | Glamidolo HCl; Reversil HCl |
Catalog Number | CSN13475 |
Alternative Name(s) | Glamidolo HCl; Reversil HCl |
Research Area | / |
Molecular Formula | C19H28ClN5 |
CAS# | 72822-13-0 |
Purity | ≥99% |
SMILES | CC1=CC=CC=C1N2CCN(CCC3=NN=C4CCCCN43)CC2.[H]Cl |
Size | 50mg |
Supplier Page | https://www.csnpharm.com/products/dapiprazole-hcl.html |