N-Oleoyl serinol | MedChemExpress (MCE)
N-Oleoyl serinol is a ceramide analog that can be used in stem cell therapy to prevent stem cells from developing into teratomas. N-Oleoyl serinol induces apoptosis in residual pluripotent embryoid body-derived cells (EBCs), prevents teratoma formation, and enriches EBC cells that undergo neural differentiation after transplantation[1].
| Trivial name | N-Oleoyl serinol |
| Catalog Number | HY-122788 |
| Alternative Name(s) | Oleoyl serinol |
| Research Area | Cancer |
| CAS# | 72809-08-6 |
| Purity | ≥98.0% |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(NC(CO)CO)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/n-oleoyl-serinol.html |