Zenidolol | MedChemExpress (MCE)
Zenidolol (ICI-118551) is a selective β2 adrenergic receptor antagonist. Zenidolol inhibits β2-, β1- and β3-adrenergic receptor with Ki values of 0.7, 49.5 and 611 nM, respectively. Zenidolol can be used as an ocular hypotensive agent used for ophthalmic disease research[1].
| Trivial name | Zenidolol |
| Catalog Number | HY-100543 |
| Alternative Name(s) | ICI-118551 |
| Research Area | Inflammation/Immunology |
| CAS# | 72795-26-7 |
| Purity | ≥98.00% |
| SMILES | C[C@@H](NC(C)C)[C@@H](O)COC1=CC=C(C)C2=C1CCC2 |
| PubChem Chemical Structure ID | 104824 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/zenidolol.html |