Mocetinostat (MGCD0103)
Mocetinostat (MGCD0103, MG0103) is a potent HDAC inhibitor with most potency for HDAC1 with IC50 of 0.15 μM in a cell-free assay, 2- to 10- fold selectivity against HDAC2, 3, and 11, and no activity to HDAC4, 5, 6, 7, and 8. Mocetinostat (MGCD0103) induces apoptosis and autophagy. Phase 2.
| Trivial name | MG0103 |
| Catalog Number | S1122 |
| Molecular Formula | C26H36N6O2 |
| CAS# | 726169-73-9 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | O=C(NCCCNC1=NC(=NC=C1C2CC2)NC3=CC=CC(=C3)CN4CCOCC4)C5CCC5 |
| Size | 10mM/1mL |
| Supplier Page | http://www.selleckchem.com/products/MGCD0103(Mocetinostat).html |
| Additional Information | https://file.selleck.cn/downloads/struct/MGCD0103-Mocetinostat-chemical-structure-S1122.gif |
