Rifabutin
Rifabutin inhibits bacterial DNA-dependent RNA polymerase, thereby suppressing the initiation of RNA formation and leading to inhibition of RNA synthesis and transcription. Rifabutin is a semisynthetic ansamycin antibiotic with potent antimycobacterial properties.
| Catalog Number | T1501 |
| Alternative Name(s) | LM-427 , Ansamycin |
| Research Area | Cytoskeletal Signaling|||DNA Damage/DNA Repair|||Cell Cycle/Checkpoint|||Microbiology/Virology|||Metabolism |
| Molecular Formula | C46H62N4O11 |
| CAS# | 72559-06-9 |
| Purity | 99.27% |
| SMILES | CO[C@H]1\C=C\O[C@@]2(C)Oc3c(C2=O)c2C4=NC5(CCN(CC(C)C)CC5)NC4=C(NC(=O)\C(C)=C/C=C/[C@H](C)[C@H](O)[C@@H](C)[C@@H](O)[C@@H](C)[C@H](OC(C)=O)[C@@H]1C)C(=O)c2c(O)c3C |
| Size | 200 mg |
| Supplier Page | https://www.targetmol.com/compound/Rifabutin |
| Additional Information | https://www.targetmol.com/datasheet/T1501 |
