Rifabutin 10mM * 1mL in DMSO
Rifabutin is a bactericidal antibiotic drug primarily used in the treatment of tuberculosis. Its effect is based on blocking the DNA-dependent RNA-polymerase of the bacteria.
Trivial name | Rifabutin 10mM * 1mL in DMSO |
Catalog Number | A10790-10mM-D |
Alternative Name(s) | N/A |
Molecular Formula | C46H62N4O11 |
CAS# | 72559-06-9 |
SMILES | C[C@H]1/C=C/C=C(C(=O)NC2=C3C(=NC4(N3)CCN(CC4)CC(C)C)C5=C6C(=C(C(=C5C2=O)O)C)O[C@@](C6=O)(O/C=C/[C@@H]([C@H]([C@H]([C@@H]([C@@H]([C@@H]([C@H]1O)C)O)C)OC(=O)C)C)OC)C)/C |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/rifabutin.html |