(17R,18S)-Epoxyeicosatetraenoic acid | MedChemExpress (MCE)
(17R,18S)-Epoxyeicosatetraenoic acid (17(R),18(S)-EETeTr) is a cytochrome P450 epoxygenase metabolite of eicosapentaenoic acid (HY-B0660). (17R,18S)-Epoxyeicosatetraenoic acid shows exerts negative chronotropic effects and protects neonatal rat cardiomyocytes against Ca2+ overload. (17R,18S)-Epoxyeicosatetraenoic acid has the potential for the research of antiarrhythmic agent[1][2].
| Trivial name | (17R,18S)-Epoxyeicosatetraenoic acid |
| Catalog Number | HY-113040A |
| Alternative Name(s) | 17(R),18(S)-EETeTr |
| Research Area | Cardiovascular Disease |
| CAS# | 725246-18-4 |
| Purity | ≥98.00% |
| SMILES | OC(CCC/C=C\C/C=C\C/C=C\C/C=C\C[C@@H]1[C@@H](O1)CC)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/17r-18s-epoxyeicosatetraenoic-acid.html |