X-GAL
X-GAL is an organic compound consisting of galactose linked to a substituted indole and is much used in molecular biology to test for the presence of an enzyme, β-galactosidase.
| Trivial name | BCIG |
| Catalog Number | CSN12904 |
| Alternative Name(s) | BCIG |
| Research Area | / |
| Molecular Formula | C14H15BrClNO6 |
| CAS# | 7240-90-6 |
| Purity | ≥98% |
| SMILES | O[C@H]1[C@H](OC2=CNC3=C2C(Cl)=C(Br)C=C3)O[C@H](CO)[C@H](O)[C@@H]1O |
| Size | 5g |
| Supplier Page | https://www.csnpharm.com/products/x-gal.html |