β-Carotene
β-Carotene is a naturally occuring retinol (vitamin A) precursor found in plants and fruits, used to reduce the severity of photosensitivity reactions in patients with erythropoietic protoporphyria.
| Trivial name | Provitamin A; Carotaben; Lucarotin |
| Catalog Number | CSN10423 |
| Alternative Name(s) | Provitamin A; Carotaben; Lucarotin |
| Research Area | Metabolic Disease |
| Molecular Formula | C40H56 |
| CAS# | 7235-40-7 |
| Purity | ≥98% |
| SMILES | CC1(C)C(/C=C/C(C)=C/C=C/C(C)=C/C=C\C=C(C)/C=C/C=C(C)/C=C/C2=C(C)CCCC2(C)C)=C(C)CCC1 |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/b-carotene.html |
