Sulfamethoxazole
Marine
| Trivial name | NULL |
| Catalog Number | CS-O-11749 |
| Alternative Name(s) | 4-amino-N-(5-methyl-1,2-oxazol-3-yl)benzene-1-sulfonamide |
| Research Area | An antibacterial drug. Sulfonamide antibiotic that blocks the synthesis of dihydrofolic acid by inhibiting the enzyme dihydropteroate synthase. |
| Molecular Formula | C10H11N3O3S |
| CAS# | 723-46-6 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=[S](NC1=NOC(C)=C1)(C2=CC=C(N)C=C2)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11749.html |
| Additional Information | NULL |
