Barasertib (AZD1152-HQPA)
Defosbarasertib (AZD1152-HQPA, AZD2811, INH-34, Barasertib-HQPA) is a highly selective Aurora B inhibitor with IC50 of 0.37 nM in a cell-free assay, ~3700 fold more selective for Aurora B over Aurora A. Phase 1.
| Trivial name | AZD2811, INH-34, Barasertib-HQPA , Defosbarasertib | 
| Catalog Number | S1147 | 
| Molecular Formula | C25H35N3O2 | 
| CAS# | 722544-51-6 | 
| Inchi | InChI=1S/C25H35N3O2/c1-4-27(5-2)19-20-10-12-22(13-11-20)25(29)28(23-14-16-26-18-23)17-15-21-8-6-7-9-24(21)30-3/h6-13,23,26H,4-5,14-19H2,1-3H3/t23-/m1/s1 | 
| Inchi Key | XKPJTOHUPQWSOJ-HSZRJFAPSA-N | 
| SMILES | CCN(CC)CC1=CC=C(C=C1)C(=O)N(CCC2=CC=CC=C2OC)C3CCNC3 | 
| Size | 5mg | 
| Supplier Page | http://www.selleckchem.com/products/AZD1152-HQPA.html | 
| Additional Information | https://file.selleck.cn/downloads/struct/AZD1152-HQPA-chemical-structure-S1147.gif | 
 
                    