Barasertib (AZD1152-HQPA)
Defosbarasertib (AZD1152-HQPA, AZD2811, INH-34, Barasertib-HQPA) is a highly selective Aurora B inhibitor with IC50 of 0.37 nM in a cell-free assay, ~3700 fold more selective for Aurora B over Aurora A. Phase 1.
| Trivial name | AZD2811, INH-34, Barasertib-HQPA , Defosbarasertib |
| Catalog Number | S1147 |
| Molecular Formula | C35H52O5S2 |
| CAS# | 722544-51-6 |
| Inchi | InChI=1S/C35H52O5S2/c1-31(2,3)23-17-21(18-24(29(23)39)32(4,5)6)41-35(13,14)42-22-19-25(33(7,8)9)30(26(20-22)34(10,11)12)40-28(38)16-15-27(36)37/h17-20,39H,15-16H2,1-14H3,(H,36,37) |
| Inchi Key | RKSMVPNZHBRNNS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)SC(C)(C)SC2=CC(=C(C(=C2)C(C)(C)C)OC(=O)CCC(=O)O)C(C)(C)C |
| Size | 10mM/1mL |
| Supplier Page | http://www.selleckchem.com/products/AZD1152-HQPA.html |
| Additional Information | https://file.selleck.cn/downloads/struct/AZD1152-HQPA-chemical-structure-S1147.gif |
