Barasertib dihydrochloride | MedChemExpress (MCE)
Barasertib (AZD1152 dihydrochloride), a pro-drug of Barasertib-hQPA, is a highly selective Aurora B inhibitor with an IC50 of 0.37 nM in a cell-free assay. Barasertib (AZD1152 dihydrochloride) induces growth arrest and apoptosis in cancer cells[1].
| Trivial name | Barasertib dihydrochloride |
| Catalog Number | HY-10127A |
| Alternative Name(s) | AZD1152 dihydrochloride |
| Research Area | Cancer |
| CAS# | 722543-50-2 |
| Purity | ≥98.0% |
| SMILES | O=C(CC1=NNC(NC2=C3C=CC(OCCCN(CCOP(O)(O)=O)CC)=CC3=NC=N2)=C1)NC4=CC(F)=CC=C4.Cl.Cl |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/barasertib-dihydrochloride.html |