α-Methyl-1-naphthaleneacetic Acid Methyl Ester
α-Methyl-1-naphthaleneacetic Acid Methyl Ester is an intermediate in the synthesis of 5-Methylchrysene (M265135), methylated derivative of chrysenes (MeChry), an aryl hydrocarbon receptor (AhR) agonist.
| Catalog Number | BB076042 |
| Alternative Name(s) | METHYL 2-(NAPHTHALEN-1-YL)PROPANOATE; methyl 2-naphthalen-1-ylpropanoate; alpha-Methyl-1-naphthaleneacetic Acid Methyl Ester; Methyl 2-(1-naphthyl)-propionate; methyl 1-naphthyl(alpha-methyl)acetate; 2-(1-Naphthyl)propanoic acid methyl ester |
| Molecular Formula | C14H14O2 |
| CAS# | 72221-62-6 |
| Inchi | InChI=1S/C14H14O2/c1-10(14(15)16-2)12-9-5-7-11-6-3-4-8-13(11)12/h3-10H,1-2H3 |
| Inchi Key | XULIAJSFPSQIKV-UHFFFAOYSA-N |
| Size | Please inquire |
| Supplier Page | https://buildingblock.bocsci.com/product/methyl-1-naphthaleneacetic-acid-methyl-ester-cas-72221-62-6-408934.html |