Kopsininic acid | MedChemExpress (MCE)
Kopsininic acid is a natural product derived from Kopsia hainanensis. Kopsininic acid can be used in the research of rheumatoid arthritis, pharyngitis, tonsillitis and edema[1].
| Trivial name | Kopsininic acid |
| Catalog Number | HY-N12243 |
| Research Area | Others |
| CAS# | 7222-19-7 |
| Purity | ≥98.00% |
| SMILES | O=C([C@@H]1C[C@@]23CCCN4CC[C@]5([C@@]43[H])C6=C(N[C@]15CC2)C=CC=C6)O |
| PubChem Chemical Structure ID | 162924421 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/kopsininic-acid.html |